C21H18N4O5S3 — CID 4847461
2-[5-(furan-2-yl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(3-sulfamoylphenyl)acetamide (PubChem CID 4847461) has the molecular formula C21H18N4O5S3 and a molecular weight of 502.60 g/mol. Its IUPAC name is 2-[5-(furan-2-yl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(3-sulfamoylphenyl)acetamide.
| Compound Name | 2-[5-(furan-2-yl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 4847461 |
| Molecular Formula | C21H18N4O5S3 |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | 2-[5-(furan-2-yl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(3-sulfamoylphenyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cccc(S(N)(=O)=O)c2)nc2scc(-c3ccco3)c2c1=O |
| InChI | InChI=1S/C21H18N4O5S3/c1-2-8-25-20(27)18-15(16-7-4-9-30-16)11-31-19(18)24-21(25)32-12-17(26)23-13-5-3-6-14(10-13)33(22,28)29/h2-7,9-11H,1,8,12H2,(H,23,26)(H2,22,28,29) |
| InChIKey | KWPPSTNBERHKPJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 137.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|