C23H20N2O5S2 — CID 4669006
2-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]sulfanyl-5-(furan-2-yl)-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 4669006) has the molecular formula C23H20N2O5S2 and a molecular weight of 468.56 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]sulfanyl-5-(furan-2-yl)-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]sulfanyl-5-(furan-2-yl)-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4669006 |
| Molecular Formula | C23H20N2O5S2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]sulfanyl-5-(furan-2-yl)-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCC(=O)c2ccc(OC)c(OC)c2)nc2scc(-c3ccco3)c2c1=O |
| InChI | InChI=1S/C23H20N2O5S2/c1-4-9-25-22(27)20-15(17-6-5-10-30-17)12-31-21(20)24-23(25)32-13-16(26)14-7-8-18(28-2)19(11-14)29-3/h4-8,10-12H,1,9,13H2,2-3H3 |
| InChIKey | CZBVORMKSULVHS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 83.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|