C26H24N4O4S2 — CID 44641098
N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide (PubChem CID 44641098) has the molecular formula C26H24N4O4S2 and a molecular weight of 520.64 g/mol. Its IUPAC name is N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 44641098 |
| Molecular Formula | C26H24N4O4S2 |
| Molecular Weight | 520.64 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)N/N=C/c2ccc(OC)c(OC)c2)nc2scc(-c3ccccc3)c2c1=O |
| InChI | InChI=1S/C26H24N4O4S2/c1-4-12-30-25(32)23-19(18-8-6-5-7-9-18)15-35-24(23)28-26(30)36-16-22(31)29-27-14-17-10-11-20(33-2)21(13-17)34-3/h4-11,13-15H,1,12,16H2,2-3H3,(H,29,31)/b27-14+ |
| InChIKey | WJUMDWQMHGRKPL-MZJWZYIUSA-N |
| XLogP | 4.57 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.64 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|