C11H17N5O2S — CID 9374358
N,N-dimethyl-2-[[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]acetamide (PubChem CID 9374358) has the molecular formula C11H17N5O2S and a molecular weight of 283.36 g/mol. Its IUPAC name is N,N-dimethyl-2-[[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 9374358 |
| Molecular Formula | C11H17N5O2S |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | N,N-dimethyl-2-[[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]acetamide |
| SMILES | C=CCn1cnnc1SCC(=O)NCC(=O)N(C)C |
| InChI | InChI=1S/C11H17N5O2S/c1-4-5-16-8-13-14-11(16)19-7-9(17)12-6-10(18)15(2)3/h4,8H,1,5-7H2,2-3H3,(H,12,17) |
| InChIKey | BHIWEZTWCIVKQU-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|