C7H8N4 — CID 136631027
4-methyl-3-(1H-pyrrol-2-yl)-1,2,4-triazole (PubChem CID 136631027) has the molecular formula C7H8N4 and a molecular weight of 148.17 g/mol. Its IUPAC name is 4-methyl-3-(1H-pyrrol-2-yl)-1,2,4-triazole.
| Compound Name | 4-methyl-3-(1H-pyrrol-2-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 136631027 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 4-methyl-3-(1H-pyrrol-2-yl)-1,2,4-triazole |
| SMILES | Cn1cnnc1-c1ccc[nH]1 |
| InChI | InChI=1S/C7H8N4/c1-11-5-9-10-7(11)6-3-2-4-8-6/h2-5,8H,1H3 |
| InChIKey | ZEYGSEDTRYHTOY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |