C12H16N4 — CID 62694681
4-methyl-2-(4-propyl-1,2,4-triazol-3-yl)aniline (PubChem CID 62694681) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 4-methyl-2-(4-propyl-1,2,4-triazol-3-yl)aniline.
| Compound Name | 4-methyl-2-(4-propyl-1,2,4-triazol-3-yl)aniline |
|---|---|
| PubChem CID | 62694681 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 4-methyl-2-(4-propyl-1,2,4-triazol-3-yl)aniline |
| SMILES | CCCn1cnnc1-c1cc(C)ccc1N |
| InChI | InChI=1S/C12H16N4/c1-3-6-16-8-14-15-12(16)10-7-9(2)4-5-11(10)13/h4-5,7-8H,3,6,13H2,1-2H3 |
| InChIKey | WBVZUJOKXSEUBM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|