C14H13N5S — CID 142249451
4-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]benzene-1,3-diamine (PubChem CID 142249451) has the molecular formula C14H13N5S and a molecular weight of 283.36 g/mol. Its IUPAC name is 4-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]benzene-1,3-diamine.
| Compound Name | 4-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 142249451 |
| Molecular Formula | C14H13N5S |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 4-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]benzene-1,3-diamine |
| SMILES | Nc1ccc(Sc2nncn2-c2ccccc2)c(N)c1 |
| InChI | InChI=1S/C14H13N5S/c15-10-6-7-13(12(16)8-10)20-14-18-17-9-19(14)11-4-2-1-3-5-11/h1-9H,15-16H2 |
| InChIKey | UMCABMLTPDLXLX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|