C12H17N3SSi — CID 56528992
trimethyl-[(4-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]silane (PubChem CID 56528992) has the molecular formula C12H17N3SSi and a molecular weight of 263.44 g/mol. Its IUPAC name is trimethyl-[(4-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]silane.
| Compound Name | trimethyl-[(4-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]silane |
|---|---|
| PubChem CID | 56528992 |
| Molecular Formula | C12H17N3SSi |
| Molecular Weight | 263.44 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | trimethyl-[(4-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]silane |
| SMILES | C[Si](C)(C)CSc1nncn1-c1ccccc1 |
| InChI | InChI=1S/C12H17N3SSi/c1-17(2,3)10-16-12-14-13-9-15(12)11-7-5-4-6-8-11/h4-9H,10H2,1-3H3 |
| InChIKey | IHRLPKCTUOLGQP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|