C12H16N4O2S2 — CID 47772818
N-[3-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]propyl]methanesulfonamide (PubChem CID 47772818) has the molecular formula C12H16N4O2S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is N-[3-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]propyl]methanesulfonamide.
| Compound Name | N-[3-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 47772818 |
| Molecular Formula | C12H16N4O2S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | N-[3-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCSc1nncn1-c1ccccc1 |
| InChI | InChI=1S/C12H16N4O2S2/c1-20(17,18)14-8-5-9-19-12-15-13-10-16(12)11-6-3-2-4-7-11/h2-4,6-7,10,14H,5,8-9H2,1H3 |
| InChIKey | WIVHSWYNGHMFSI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|