C15H18N4O3S — CID 9345253
methyl 4-[[2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]butanoate (PubChem CID 9345253) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is methyl 4-[[2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 9345253 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | methyl 4-[[2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)CSc1nncn1-c1ccccc1 |
| InChI | InChI=1S/C15H18N4O3S/c1-22-14(21)8-5-9-16-13(20)10-23-15-18-17-11-19(15)12-6-3-2-4-7-12/h2-4,6-7,11H,5,8-10H2,1H3,(H,16,20) |
| InChIKey | HWPDHUDFDNFEBV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|