C17H22N4O3S — CID 119219999
6-[[2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]hexanoic acid (PubChem CID 119219999) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is 6-[[2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 119219999 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 6-[[2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]hexanoic acid |
| SMILES | Cc1ccc(-n2cnnc2SCC(=O)NCCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C17H22N4O3S/c1-13-6-8-14(9-7-13)21-12-19-20-17(21)25-11-15(22)18-10-4-2-3-5-16(23)24/h6-9,12H,2-5,10-11H2,1H3,(H,18,22)(H,23,24) |
| InChIKey | CSOMHIPHKSSMJL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|