C14H17ClN4O2S — CID 78854393
2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-hydroxypropyl)acetamide (PubChem CID 78854393) has the molecular formula C14H17ClN4O2S and a molecular weight of 340.84 g/mol. Its IUPAC name is 2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-hydroxypropyl)acetamide.
| Compound Name | 2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-hydroxypropyl)acetamide |
|---|---|
| PubChem CID | 78854393 |
| Molecular Formula | C14H17ClN4O2S |
| Molecular Weight | 340.84 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-hydroxypropyl)acetamide |
| SMILES | Cc1ccc(-n2cnnc2SCC(=O)NCCCO)cc1Cl |
| InChI | InChI=1S/C14H17ClN4O2S/c1-10-3-4-11(7-12(10)15)19-9-17-18-14(19)22-8-13(21)16-5-2-6-20/h3-4,7,9,20H,2,5-6,8H2,1H3,(H,16,21) |
| InChIKey | RXINZXCCXQDDNV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.84 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|