C16H21ClN4O2S — CID 24663971
2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-ethoxypropyl)acetamide (PubChem CID 24663971) has the molecular formula C16H21ClN4O2S and a molecular weight of 368.89 g/mol. Its IUPAC name is 2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-ethoxypropyl)acetamide.
| Compound Name | 2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-ethoxypropyl)acetamide |
|---|---|
| PubChem CID | 24663971 |
| Molecular Formula | C16H21ClN4O2S |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-ethoxypropyl)acetamide |
| SMILES | CCOCCCNC(=O)CSc1nncn1-c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C16H21ClN4O2S/c1-3-23-8-4-7-18-15(22)10-24-16-20-19-11-21(16)13-6-5-12(2)14(17)9-13/h5-6,9,11H,3-4,7-8,10H2,1-2H3,(H,18,22) |
| InChIKey | KZUIUPXXKPUVPD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|