C21H23ClN4O3S2 — CID 55844001
N-(3-benzylsulfonylpropyl)-2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 55844001) has the molecular formula C21H23ClN4O3S2 and a molecular weight of 479.03 g/mol. Its IUPAC name is N-(3-benzylsulfonylpropyl)-2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-benzylsulfonylpropyl)-2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 55844001 |
| Molecular Formula | C21H23ClN4O3S2 |
| Molecular Weight | 479.03 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | N-(3-benzylsulfonylpropyl)-2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(-n2cnnc2SCC(=O)NCCCS(=O)(=O)Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C21H23ClN4O3S2/c1-16-8-9-18(12-19(16)22)26-15-24-25-21(26)30-13-20(27)23-10-5-11-31(28,29)14-17-6-3-2-4-7-17/h2-4,6-9,12,15H,5,10-11,13-14H2,1H3,(H,23,27) |
| InChIKey | FDRUXPDLJWUENW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.03 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|