C24H29ClN6OS — CID 33137430
2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(4-phenylpiperazin-1-yl)propyl]acetamide (PubChem CID 33137430) has the molecular formula C24H29ClN6OS and a molecular weight of 485.06 g/mol. Its IUPAC name is 2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(4-phenylpiperazin-1-yl)propyl]acetamide.
| Compound Name | 2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(4-phenylpiperazin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 33137430 |
| Molecular Formula | C24H29ClN6OS |
| Molecular Weight | 485.06 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(4-phenylpiperazin-1-yl)propyl]acetamide |
| SMILES | Cc1ccc(-n2cnnc2SCC(=O)NCCCN2CCN(c3ccccc3)CC2)cc1Cl |
| InChI | InChI=1S/C24H29ClN6OS/c1-19-8-9-21(16-22(19)25)31-18-27-28-24(31)33-17-23(32)26-10-5-11-29-12-14-30(15-13-29)20-6-3-2-4-7-20/h2-4,6-9,16,18H,5,10-15,17H2,1H3,(H,26,32) |
| InChIKey | CQDCUHRXYVDMIU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.06 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|