C17H23ClN4OS — CID 33077316
2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methylpentyl)acetamide (PubChem CID 33077316) has the molecular formula C17H23ClN4OS and a molecular weight of 366.92 g/mol. Its IUPAC name is 2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methylpentyl)acetamide.
| Compound Name | 2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methylpentyl)acetamide |
|---|---|
| PubChem CID | 33077316 |
| Molecular Formula | C17H23ClN4OS |
| Molecular Weight | 366.92 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methylpentyl)acetamide |
| SMILES | Cc1ccc(-n2cnnc2SCC(=O)NCCCC(C)C)cc1Cl |
| InChI | InChI=1S/C17H23ClN4OS/c1-12(2)5-4-8-19-16(23)10-24-17-21-20-11-22(17)14-7-6-13(3)15(18)9-14/h6-7,9,11-12H,4-5,8,10H2,1-3H3,(H,19,23) |
| InChIKey | HYSCUBYJMYKWLA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.92 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|