C16H9F5N4OS — CID 2358275
N-(2,3,4,5,6-pentafluorophenyl)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 2358275) has the molecular formula C16H9F5N4OS and a molecular weight of 400.33 g/mol. Its IUPAC name is N-(2,3,4,5,6-pentafluorophenyl)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(2,3,4,5,6-pentafluorophenyl)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 2358275 |
| Molecular Formula | C16H9F5N4OS |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | N-(2,3,4,5,6-pentafluorophenyl)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nncn1-c1ccccc1)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H9F5N4OS/c17-10-11(18)13(20)15(14(21)12(10)19)23-9(26)6-27-16-24-22-7-25(16)8-4-2-1-3-5-8/h1-5,7H,6H2,(H,23,26) |
| InChIKey | NBJGVYODLPRBPC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|