C17H15BrN6OS2 — CID 53242275
1-(4-bromophenyl)-3-[[2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]thiourea (PubChem CID 53242275) has the molecular formula C17H15BrN6OS2 and a molecular weight of 463.39 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[[2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]thiourea.
| Compound Name | 1-(4-bromophenyl)-3-[[2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]thiourea |
|---|---|
| PubChem CID | 53242275 |
| Molecular Formula | C17H15BrN6OS2 |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | 1-(4-bromophenyl)-3-[[2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]thiourea |
| SMILES | O=C(CSc1nncn1-c1ccccc1)NNC(=S)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H15BrN6OS2/c18-12-6-8-13(9-7-12)20-16(26)22-21-15(25)10-27-17-23-19-11-24(17)14-4-2-1-3-5-14/h1-9,11H,10H2,(H,21,25)(H2,20,22,26) |
| InChIKey | XOQFLYDXCRMJOS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|