C23H21N7OS2 — CID 42598009
1-(4-methylphenyl)-3-[[2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]thiourea (PubChem CID 42598009) has the molecular formula C23H21N7OS2 and a molecular weight of 475.60 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-[[2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]thiourea.
| Compound Name | 1-(4-methylphenyl)-3-[[2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]thiourea |
|---|---|
| PubChem CID | 42598009 |
| Molecular Formula | C23H21N7OS2 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 1-(4-methylphenyl)-3-[[2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]thiourea |
| SMILES | Cc1ccc(NC(=S)NNC(=O)CSc2nnc(-c3ccncc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21N7OS2/c1-16-7-9-18(10-8-16)25-22(32)28-26-20(31)15-33-23-29-27-21(17-11-13-24-14-12-17)30(23)19-5-3-2-4-6-19/h2-14H,15H2,1H3,(H,26,31)(H2,25,28,32) |
| InChIKey | BWIWFZHJEXLDSF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|