C28H29ClN6OS2 — CID 4233552
1-[[2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-3-(4-chlorophenyl)thiourea (PubChem CID 4233552) has the molecular formula C28H29ClN6OS2 and a molecular weight of 565.17 g/mol. Its IUPAC name is 1-[[2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-3-(4-chlorophenyl)thiourea.
| Compound Name | 1-[[2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-3-(4-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 4233552 |
| Molecular Formula | C28H29ClN6OS2 |
| Molecular Weight | 565.17 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | 1-[[2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-3-(4-chlorophenyl)thiourea |
| SMILES | Cc1ccc(-n2c(SCC(=O)NNC(=S)Nc3ccc(Cl)cc3)nnc2-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H29ClN6OS2/c1-18-5-15-23(16-6-18)35-25(19-7-9-20(10-8-19)28(2,3)4)32-34-27(35)38-17-24(36)31-33-26(37)30-22-13-11-21(29)12-14-22/h5-16H,17H2,1-4H3,(H,31,36)(H2,30,33,37) |
| InChIKey | IZYMTEDFGGTFMW-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.17 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|