C18H17BrN6OS2 — CID 71661031
1-(4-bromophenyl)-3-[[2-[(5-methyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]thiourea (PubChem CID 71661031) has the molecular formula C18H17BrN6OS2 and a molecular weight of 477.41 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[[2-[(5-methyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]thiourea.
| Compound Name | 1-(4-bromophenyl)-3-[[2-[(5-methyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]thiourea |
|---|---|
| PubChem CID | 71661031 |
| Molecular Formula | C18H17BrN6OS2 |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | 1-(4-bromophenyl)-3-[[2-[(5-methyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]thiourea |
| SMILES | Cc1nnc(SCC(=O)NNC(=S)Nc2ccc(Br)cc2)n1-c1ccccc1 |
| InChI | InChI=1S/C18H17BrN6OS2/c1-12-21-24-18(25(12)15-5-3-2-4-6-15)28-11-16(26)22-23-17(27)20-14-9-7-13(19)8-10-14/h2-10H,11H2,1H3,(H,22,26)(H2,20,23,27) |
| InChIKey | WXBFGNWEFIPTJB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|