C21H16BrN7O4S2 — CID 46700861
1-[[2-[[4-(4-bromophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-3-(4-nitrophenyl)thiourea (PubChem CID 46700861) has the molecular formula C21H16BrN7O4S2 and a molecular weight of 574.44 g/mol. Its IUPAC name is 1-[[2-[[4-(4-bromophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-[[2-[[4-(4-bromophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 46700861 |
| Molecular Formula | C21H16BrN7O4S2 |
| Molecular Weight | 574.44 g/mol |
| Exact Mass | 572.99 |
| IUPAC Name | 1-[[2-[[4-(4-bromophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-3-(4-nitrophenyl)thiourea |
| SMILES | O=C(CSc1nnc(-c2ccco2)n1-c1ccc(Br)cc1)NNC(=S)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H16BrN7O4S2/c22-13-3-7-15(8-4-13)28-19(17-2-1-11-33-17)25-27-21(28)35-12-18(30)24-26-20(34)23-14-5-9-16(10-6-14)29(31)32/h1-11H,12H2,(H,24,30)(H2,23,26,34) |
| InChIKey | UVTSSKUFLQUSBT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 140.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|