C4H10N6 — CID 104899966
5-[(1R)-1-aminoethyl]-1,2,4-triazole-3,4-diamine (PubChem CID 104899966) has the molecular formula C4H10N6 and a molecular weight of 142.17 g/mol. Its IUPAC name is 5-[(1R)-1-aminoethyl]-1,2,4-triazole-3,4-diamine.
| Compound Name | 5-[(1R)-1-aminoethyl]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 104899966 |
| Molecular Formula | C4H10N6 |
| Molecular Weight | 142.17 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 5-[(1R)-1-aminoethyl]-1,2,4-triazole-3,4-diamine |
| SMILES | C[C@@H](N)c1nnc(N)n1N |
| InChI | InChI=1S/C4H10N6/c1-2(5)3-8-9-4(6)10(3)7/h2H,5,7H2,1H3,(H2,6,9)/t2-/m1/s1 |
| InChIKey | WMTLGYLDRMUNRB-UWTATZPHSA-N |
| XLogP | -1.41 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.17 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |