C9H18N4 — CID 62692198
N-methyl-3-(4-propyl-1,2,4-triazol-3-yl)propan-1-amine (PubChem CID 62692198) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is N-methyl-3-(4-propyl-1,2,4-triazol-3-yl)propan-1-amine.
| Compound Name | N-methyl-3-(4-propyl-1,2,4-triazol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 62692198 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | N-methyl-3-(4-propyl-1,2,4-triazol-3-yl)propan-1-amine |
| SMILES | CCCn1cnnc1CCCNC |
| InChI | InChI=1S/C9H18N4/c1-3-7-13-8-11-12-9(13)5-4-6-10-2/h8,10H,3-7H2,1-2H3 |
| InChIKey | FBCZIXTXGWEHDT-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|