About N-[(4-propyl-1,2,4-triazol-3-yl)methyl]butan-2-amine
N-[(4-propyl-1,2,4-triazol-3-yl)methyl]butan-2-amine (PubChem CID 62694664) has the molecular formula C10H20N4
and a molecular weight of 196.30 g/mol. Its IUPAC name is N-[(4-propyl-1,2,4-triazol-3-yl)methyl]butan-2-amine.
Analyze N-[(4-propyl-1,2,4-triazol-3-yl)methyl]butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-propyl-1,2,4-triazol-3-yl)methyl]butan-2-amine?
The IUPAC name of N-[(4-propyl-1,2,4-triazol-3-yl)methyl]butan-2-amine (CID 62694664) is N-[(4-propyl-1,2,4-triazol-3-yl)methyl]butan-2-amine.
What is the SMILES notation for N-[(4-propyl-1,2,4-triazol-3-yl)methyl]butan-2-amine?
The canonical SMILES for N-[(4-propyl-1,2,4-triazol-3-yl)methyl]butan-2-amine is CCCn1cnnc1CNC(C)CC.
What is the InChIKey of N-[(4-propyl-1,2,4-triazol-3-yl)methyl]butan-2-amine?
The InChIKey is UQJUFNJGOAXWAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4/c1-4-6-14-8-12-13-10(14)7-11-9(3)5-2/h8-9,11H,4-7H2,1-3H3.
What are the key properties of N-[(4-propyl-1,2,4-triazol-3-yl)methyl]butan-2-amine?
N-[(4-propyl-1,2,4-triazol-3-yl)methyl]butan-2-amine has a molecular weight of 196.30 g/mol, XLogP of 1.58, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-propyl-1,2,4-triazol-3-yl)methyl]butan-2-amine is sourced from PubChem (CID 62694664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).