C14H21N5O — CID 131910883
N-[(4-propyl-1,2,4-triazol-3-yl)methyl]-2-pyrrol-1-ylbutanamide (PubChem CID 131910883) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is N-[(4-propyl-1,2,4-triazol-3-yl)methyl]-2-pyrrol-1-ylbutanamide.
| Compound Name | N-[(4-propyl-1,2,4-triazol-3-yl)methyl]-2-pyrrol-1-ylbutanamide |
|---|---|
| PubChem CID | 131910883 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | N-[(4-propyl-1,2,4-triazol-3-yl)methyl]-2-pyrrol-1-ylbutanamide |
| SMILES | CCCn1cnnc1CNC(=O)C(CC)n1cccc1 |
| InChI | InChI=1S/C14H21N5O/c1-3-7-19-11-16-17-13(19)10-15-14(20)12(4-2)18-8-5-6-9-18/h5-6,8-9,11-12H,3-4,7,10H2,1-2H3,(H,15,20) |
| InChIKey | HDZFFHRJLNGDEW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |