C12H22N4 — CID 62710749
3-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-methylpropan-1-amine (PubChem CID 62710749) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 3-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-methylpropan-1-amine.
| Compound Name | 3-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 62710749 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 3-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-methylpropan-1-amine |
| SMILES | CNCCCc1nncn1C1CCCCC1 |
| InChI | InChI=1S/C12H22N4/c1-13-9-5-8-12-15-14-10-16(12)11-6-3-2-4-7-11/h10-11,13H,2-9H2,1H3 |
| InChIKey | FAAWOWFXHWQOEN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|