C15H12BrN3 — CID 115393272
3-[(3-bromophenyl)methyl]-4-phenyl-1,2,4-triazole (PubChem CID 115393272) has the molecular formula C15H12BrN3 and a molecular weight of 314.19 g/mol. Its IUPAC name is 3-[(3-bromophenyl)methyl]-4-phenyl-1,2,4-triazole.
| Compound Name | 3-[(3-bromophenyl)methyl]-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 115393272 |
| Molecular Formula | C15H12BrN3 |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 3-[(3-bromophenyl)methyl]-4-phenyl-1,2,4-triazole |
| SMILES | Brc1cccc(Cc2nncn2-c2ccccc2)c1 |
| InChI | InChI=1S/C15H12BrN3/c16-13-6-4-5-12(9-13)10-15-18-17-11-19(15)14-7-2-1-3-8-14/h1-9,11H,10H2 |
| InChIKey | JKWCRLSLRNZYTN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |