About methanol;3-phenyl-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-4-one
methanol;3-phenyl-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 161063527) has the molecular formula C15H18N4O2
and a molecular weight of 286.34 g/mol. Its IUPAC name is methanol;3-phenyl-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | methanol;3-phenyl-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 161063527 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | methanol;3-phenyl-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CC(C)n1nc(-c2ccccc2)c2c(=O)[nH]cnc21.CO |
| InChI | InChI=1S/C14H14N4O.CH4O/c1-9(2)18-13-11(14(19)16-8-15-13)12(17-18)10-6-4-3-5-7-10;1-2/h3-9H,1-2H3,(H,15,16,19);2H,1H3 |
| InChIKey | UDSBUFBOAYOWSS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methanol;3-phenyl-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;3-phenyl-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of methanol;3-phenyl-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-4-one (CID 161063527) is methanol;3-phenyl-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for methanol;3-phenyl-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for methanol;3-phenyl-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-4-one is CC(C)n1nc(-c2ccccc2)c2c(=O)[nH]cnc21.CO.
What is the InChIKey of methanol;3-phenyl-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is UDSBUFBOAYOWSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O.CH4O/c1-9(2)18-13-11(14(19)16-8-15-13)12(17-18)10-6-4-3-5-7-10;1-2/h3-9H,1-2H3,(H,15,16,19);2H,1H3.
What are the key properties of methanol;3-phenyl-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
methanol;3-phenyl-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 286.34 g/mol, XLogP of 1.98, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;3-phenyl-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 161063527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).