C22H16FeN4O2 — CID 164575700
cyclopenta-1,3-diene;7-cyclopenta-2,4-dien-1-yl-3-(4-nitrophenyl)pyrazolo[1,5-a]pyrimidine;iron(2+) (PubChem CID 164575700) has the molecular formula C22H16FeN4O2 and a molecular weight of 424.24 g/mol. Its IUPAC name is cyclopenta-1,3-diene;7-cyclopenta-2,4-dien-1-yl-3-(4-nitrophenyl)pyrazolo[1,5-a]pyrimidine;iron(2+).
| Compound Name | cyclopenta-1,3-diene;7-cyclopenta-2,4-dien-1-yl-3-(4-nitrophenyl)pyrazolo[1,5-a]pyrimidine;iron(2+) |
|---|---|
| PubChem CID | 164575700 |
| Molecular Formula | C22H16FeN4O2 |
| Molecular Weight | 424.24 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | cyclopenta-1,3-diene;7-cyclopenta-2,4-dien-1-yl-3-(4-nitrophenyl)pyrazolo[1,5-a]pyrimidine;iron(2+) |
| SMILES | O=[N+]([O-])c1ccc(-c2cnn3c(-[c-]4cccc4)ccnc23)cc1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C17H11N4O2.C5H5.Fe/c22-21(23)14-7-5-12(6-8-14)15-11-19-20-16(9-10-18-17(15)20)13-3-1-2-4-13;1-2-4-5-3-1;/h1-11H;1-5H;/q2*-1;+2 |
| InChIKey | AHHUIKZVJDQJQY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.24 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|