C21H15N5O3S — CID 22394185
8-(1H-benzimidazol-2-ylsulfinylmethyl)-3-(4-nitrophenyl)imidazo[1,2-a]pyridine (PubChem CID 22394185) has the molecular formula C21H15N5O3S and a molecular weight of 417.45 g/mol. Its IUPAC name is 8-(1H-benzimidazol-2-ylsulfinylmethyl)-3-(4-nitrophenyl)imidazo[1,2-a]pyridine.
| Compound Name | 8-(1H-benzimidazol-2-ylsulfinylmethyl)-3-(4-nitrophenyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 22394185 |
| Molecular Formula | C21H15N5O3S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 8-(1H-benzimidazol-2-ylsulfinylmethyl)-3-(4-nitrophenyl)imidazo[1,2-a]pyridine |
| SMILES | O=[N+]([O-])c1ccc(-c2cnc3c(CS(=O)c4nc5ccccc5[nH]4)cccn23)cc1 |
| InChI | InChI=1S/C21H15N5O3S/c27-26(28)16-9-7-14(8-10-16)19-12-22-20-15(4-3-11-25(19)20)13-30(29)21-23-17-5-1-2-6-18(17)24-21/h1-12H,13H2,(H,23,24) |
| InChIKey | NTEYUMYNJAESBH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|