C17H21N3O2S — CID 87999037
2-(1H-benzimidazol-2-ylsulfinylmethyl)-3,4,5-trimethylaniline;hydrate (PubChem CID 87999037) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfinylmethyl)-3,4,5-trimethylaniline;hydrate.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfinylmethyl)-3,4,5-trimethylaniline;hydrate |
|---|---|
| PubChem CID | 87999037 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfinylmethyl)-3,4,5-trimethylaniline;hydrate |
| SMILES | Cc1cc(N)c(CS(=O)c2nc3ccccc3[nH]2)c(C)c1C.O |
| InChI | InChI=1S/C17H19N3OS.H2O/c1-10-8-14(18)13(12(3)11(10)2)9-22(21)17-19-15-6-4-5-7-16(15)20-17;/h4-8H,9,18H2,1-3H3,(H,19,20);1H2 |
| InChIKey | BPORYOLDBQTANN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|