C16H19N3O2S — CID 22394066
2-(1H-benzimidazol-2-ylsulfinylmethyl)-3,6-dimethylaniline;hydrate (PubChem CID 22394066) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfinylmethyl)-3,6-dimethylaniline;hydrate.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfinylmethyl)-3,6-dimethylaniline;hydrate |
|---|---|
| PubChem CID | 22394066 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfinylmethyl)-3,6-dimethylaniline;hydrate |
| SMILES | Cc1ccc(C)c(CS(=O)c2nc3ccccc3[nH]2)c1N.O |
| InChI | InChI=1S/C16H17N3OS.H2O/c1-10-7-8-11(2)15(17)12(10)9-21(20)16-18-13-5-3-4-6-14(13)19-16;/h3-8H,9,17H2,1-2H3,(H,18,19);1H2 |
| InChIKey | HBDQZKCSUXBZCJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|