C20H17FN3O3+ — CID 34909240
1-(4-fluorophenyl)-2-[3-(4-nitrophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanone (PubChem CID 34909240) has the molecular formula C20H17FN3O3+ and a molecular weight of 366.37 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-[3-(4-nitrophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanone.
| Compound Name | 1-(4-fluorophenyl)-2-[3-(4-nitrophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 34909240 |
| Molecular Formula | C20H17FN3O3+ |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-(4-fluorophenyl)-2-[3-(4-nitrophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanone |
| SMILES | O=C(C[n+]1cc(-c2ccc([N+](=O)[O-])cc2)n2c1CCC2)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H17FN3O3/c21-16-7-3-15(4-8-16)19(25)13-22-12-18(23-11-1-2-20(22)23)14-5-9-17(10-6-14)24(26)27/h3-10,12H,1-2,11,13H2/q+1 |
| InChIKey | MAWKUQIHURBZKK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 69.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|