C26H25BrN3O3+ — CID 45132251
[4-[3-(2,4-dimethoxyphenyl)-4,5-dihydroimidazo[1,2-a]quinolin-10-ium-2-yl]phenyl]-methyl-oxoazanium bromide (PubChem CID 45132251) has the molecular formula C26H25BrN3O3+ and a molecular weight of 507.41 g/mol. Its IUPAC name is [4-[3-(2,4-dimethoxyphenyl)-4,5-dihydroimidazo[1,2-a]quinolin-10-ium-2-yl]phenyl]-methyl-oxoazanium bromide.
| Compound Name | [4-[3-(2,4-dimethoxyphenyl)-4,5-dihydroimidazo[1,2-a]quinolin-10-ium-2-yl]phenyl]-methyl-oxoazanium bromide |
|---|---|
| PubChem CID | 45132251 |
| Molecular Formula | C26H25BrN3O3+ |
| Molecular Weight | 507.41 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | [4-[3-(2,4-dimethoxyphenyl)-4,5-dihydroimidazo[1,2-a]quinolin-10-ium-2-yl]phenyl]-methyl-oxoazanium bromide |
| SMILES | COc1ccc(-n2c(-c3ccc([N+](C)=O)cc3)c[n+]3c2CCc2ccccc2-3)c(OC)c1.[Br-] |
| InChI | InChI=1S/C26H25N3O3.BrH/c1-27(30)20-11-8-19(9-12-20)24-17-28-22-7-5-4-6-18(22)10-15-26(28)29(24)23-14-13-21(31-2)16-25(23)32-3;/h4-9,11-14,16-17H,10,15H2,1-3H3;1H/q+2;/p-1 |
| InChIKey | LJOHCJLRFKNUJU-UHFFFAOYSA-M |
| XLogP | 1.58 |
| TPSA | 47.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|