C13H15NO4 — CID 117013794
1-(2,4-dimethoxyphenyl)piperidine-2,3-dione (PubChem CID 117013794) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)piperidine-2,3-dione.
| Compound Name | 1-(2,4-dimethoxyphenyl)piperidine-2,3-dione |
|---|---|
| PubChem CID | 117013794 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)piperidine-2,3-dione |
| SMILES | COc1ccc(N2CCCC(=O)C2=O)c(OC)c1 |
| InChI | InChI=1S/C13H15NO4/c1-17-9-5-6-10(12(8-9)18-2)14-7-3-4-11(15)13(14)16/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | MQQMJNJEFQPUEB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|