C26H24N2O8 — CID 21058600
1,6-bis(2,4-dimethoxyphenyl)-2,7-dihydro-[1,3]oxazino[4,5-g][3,1]benzoxazine-4,9-dione (PubChem CID 21058600) has the molecular formula C26H24N2O8 and a molecular weight of 492.48 g/mol. Its IUPAC name is 1,6-bis(2,4-dimethoxyphenyl)-2,7-dihydro-[1,3]oxazino[4,5-g][3,1]benzoxazine-4,9-dione.
| Compound Name | 1,6-bis(2,4-dimethoxyphenyl)-2,7-dihydro-[1,3]oxazino[4,5-g][3,1]benzoxazine-4,9-dione |
|---|---|
| PubChem CID | 21058600 |
| Molecular Formula | C26H24N2O8 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 1,6-bis(2,4-dimethoxyphenyl)-2,7-dihydro-[1,3]oxazino[4,5-g][3,1]benzoxazine-4,9-dione |
| SMILES | COc1ccc(N2COC(=O)c3cc4c(cc32)C(=O)OCN4c2ccc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C26H24N2O8/c1-31-15-5-7-19(23(9-15)33-3)27-13-35-25(29)17-12-22-18(11-21(17)27)26(30)36-14-28(22)20-8-6-16(32-2)10-24(20)34-4/h5-12H,13-14H2,1-4H3 |
| InChIKey | QFTJSYGBAJZADQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |