C15H12N2O4 — CID 3576682
6-(2,4-dimethoxyphenyl)pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 3576682) has the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is 6-(2,4-dimethoxyphenyl)pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-(2,4-dimethoxyphenyl)pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 3576682 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 6-(2,4-dimethoxyphenyl)pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | COc1ccc(N2C(=O)c3cccnc3C2=O)c(OC)c1 |
| InChI | InChI=1S/C15H12N2O4/c1-20-9-5-6-11(12(8-9)21-2)17-14(18)10-4-3-7-16-13(10)15(17)19/h3-8H,1-2H3 |
| InChIKey | OKJMMYSEWMVUAA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|