C18H17N3O5 — CID 113202613
N-(2,5-dimethoxyphenyl)-3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)propanamide (PubChem CID 113202613) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)propanamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)propanamide |
|---|---|
| PubChem CID | 113202613 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)propanamide |
| SMILES | COc1ccc(OC)c(NC(=O)CCN2C(=O)c3cccnc3C2=O)c1 |
| InChI | InChI=1S/C18H17N3O5/c1-25-11-5-6-14(26-2)13(10-11)20-15(22)7-9-21-17(23)12-4-3-8-19-16(12)18(21)24/h3-6,8,10H,7,9H2,1-2H3,(H,20,22) |
| InChIKey | XQVSEJIMKMYZGD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|