C18H17N3O4 — CID 113202520
3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-[(2-methoxyphenyl)methyl]propanamide (PubChem CID 113202520) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is 3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-[(2-methoxyphenyl)methyl]propanamide.
| Compound Name | 3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-[(2-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 113202520 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-[(2-methoxyphenyl)methyl]propanamide |
| SMILES | COc1ccccc1CNC(=O)CCN1C(=O)c2cccnc2C1=O |
| InChI | InChI=1S/C18H17N3O4/c1-25-14-7-3-2-5-12(14)11-20-15(22)8-10-21-17(23)13-6-4-9-19-16(13)18(21)24/h2-7,9H,8,10-11H2,1H3,(H,20,22) |
| InChIKey | KBRUWLPKYPIAFU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|