C19H19N3O6 — CID 113082138
N-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 113082138) has the molecular formula C19H19N3O6 and a molecular weight of 385.38 g/mol. Its IUPAC name is N-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 113082138 |
| Molecular Formula | C19H19N3O6 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | N-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCN2C(=O)c3cccnc3C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C19H19N3O6/c1-26-13-9-11(10-14(27-2)16(13)28-3)17(23)21-7-8-22-18(24)12-5-4-6-20-15(12)19(22)25/h4-6,9-10H,7-8H2,1-3H3,(H,21,23) |
| InChIKey | RJCAVAUSDGOTTA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|