C8H6N2O3 — CID 59172841
6-methoxypyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 59172841) has the molecular formula C8H6N2O3 and a molecular weight of 178.15 g/mol. Its IUPAC name is 6-methoxypyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-methoxypyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 59172841 |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 6-methoxypyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | CON1C(=O)c2cccnc2C1=O |
| InChI | InChI=1S/C8H6N2O3/c1-13-10-7(11)5-3-2-4-9-6(5)8(10)12/h2-4H,1H3 |
| InChIKey | VUMDJFQEQCVPTL-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|