About 3,4-Pyridinedicarboximide
3,4-Pyridinedicarboximide (PubChem CID 72926) has the molecular formula C7H4N2O2
and a molecular weight of 148.12 g/mol. Its IUPAC name is pyrrolo[3,4-c]pyridine-1,3-dione.
Molecular Properties
| Compound Name | 3,4-Pyridinedicarboximide |
| PubChem CID | 72926 |
| Molecular Formula | C7H4N2O2 |
| Molecular Weight | 148.12 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | pyrrolo[3,4-c]pyridine-1,3-dione |
| SMILES | C1=CN=CC2=C1C(=O)NC2=O |
| InChI | InChI=1S/C7H4N2O2/c10-6-4-1-2-8-3-5(4)7(11)9-6/h1-3H,(H,9,10,11) |
| InChIKey | SJSABZBUTDSWMJ-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | 214 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.12 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3,4-Pyridinedicarboximide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-Pyridinedicarboximide?
The IUPAC name of 3,4-Pyridinedicarboximide (CID 72926) is pyrrolo[3,4-c]pyridine-1,3-dione.
What is the SMILES notation for 3,4-Pyridinedicarboximide?
The canonical SMILES for 3,4-Pyridinedicarboximide is C1=CN=CC2=C1C(=O)NC2=O.
What is the InChIKey of 3,4-Pyridinedicarboximide?
The InChIKey is SJSABZBUTDSWMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O2/c10-6-4-1-2-8-3-5(4)7(11)9-6/h1-3H,(H,9,10,11).
What are the key properties of 3,4-Pyridinedicarboximide?
3,4-Pyridinedicarboximide has a molecular weight of 148.12 g/mol, XLogP of -0.40, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-Pyridinedicarboximide is sourced from PubChem (CID 72926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).