About 1-Methylnicotinamide
1-Methylnicotinamide (PubChem CID 457) has the molecular formula C7H9N2O+
and a molecular weight of 137.16 g/mol. Its IUPAC name is 1-methylpyridin-1-ium-3-carboxamide.
Molecular Properties
| Compound Name | 1-Methylnicotinamide |
| PubChem CID | 457 |
| Molecular Formula | C7H9N2O+ |
| Molecular Weight | 137.16 g/mol |
| Exact Mass | 137.07 |
| IUPAC Name | 1-methylpyridin-1-ium-3-carboxamide |
| SMILES | C[N+]1=CC=CC(=C1)C(=O)N |
| InChI | InChI=1S/C7H8N2O/c1-9-4-2-3-6(5-9)7(8)10/h2-5H,1H3,(H-,8,10)/p+1 |
| InChIKey | LDHMAVIPBRSVRG-UHFFFAOYSA-O |
| XLogP | -0.10 |
| TPSA | 47.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | 136 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.16 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-Methylnicotinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-Methylnicotinamide?
The IUPAC name of 1-Methylnicotinamide (CID 457) is 1-methylpyridin-1-ium-3-carboxamide.
What is the SMILES notation for 1-Methylnicotinamide?
The canonical SMILES for 1-Methylnicotinamide is C[N+]1=CC=CC(=C1)C(=O)N.
What is the InChIKey of 1-Methylnicotinamide?
The InChIKey is LDHMAVIPBRSVRG-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H8N2O/c1-9-4-2-3-6(5-9)7(8)10/h2-5H,1H3,(H-,8,10)/p+1.
What are the key properties of 1-Methylnicotinamide?
1-Methylnicotinamide has a molecular weight of 137.16 g/mol, XLogP of -0.10, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-Methylnicotinamide is sourced from PubChem (CID 457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).