About Nicotinuric Acid
Nicotinuric Acid (PubChem CID 68499) has the molecular formula C8H8N2O3
and a molecular weight of 180.16 g/mol. Its IUPAC name is 2-(pyridine-3-carbonylamino)acetic acid.
Molecular Properties
| Compound Name | Nicotinuric Acid |
| PubChem CID | 68499 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 2-(pyridine-3-carbonylamino)acetic acid |
| SMILES | C1=CC(=CN=C1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C8H8N2O3/c11-7(12)5-10-8(13)6-2-1-3-9-4-6/h1-4H,5H2,(H,10,13)(H,11,12) |
| InChIKey | ZBSGKPYXQINNGF-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | 206 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Nicotinuric Acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Nicotinuric Acid?
The IUPAC name of Nicotinuric Acid (CID 68499) is 2-(pyridine-3-carbonylamino)acetic acid.
What is the SMILES notation for Nicotinuric Acid?
The canonical SMILES for Nicotinuric Acid is C1=CC(=CN=C1)C(=O)NCC(=O)O.
What is the InChIKey of Nicotinuric Acid?
The InChIKey is ZBSGKPYXQINNGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O3/c11-7(12)5-10-8(13)6-2-1-3-9-4-6/h1-4H,5H2,(H,10,13)(H,11,12).
What are the key properties of Nicotinuric Acid?
Nicotinuric Acid has a molecular weight of 180.16 g/mol, XLogP of -0.40, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Nicotinuric Acid is sourced from PubChem (CID 68499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).