About Flonicamid
Flonicamid (PubChem CID 9834513) has the molecular formula C9H6F3N3O
and a molecular weight of 229.16 g/mol. Its IUPAC name is N-(cyanomethyl)-4-(trifluoromethyl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | Flonicamid |
| PubChem CID | 9834513 |
| Molecular Formula | C9H6F3N3O |
| Molecular Weight | 229.16 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | N-(cyanomethyl)-4-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | C1=CN=CC(=C1C(F)(F)F)C(=O)NCC#N |
| InChI | InChI=1S/C9H6F3N3O/c10-9(11,12)7-1-3-14-5-6(7)8(16)15-4-2-13/h1,3,5H,4H2,(H,15,16) |
| InChIKey | RLQJEEJISHYWON-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 65.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | 307 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.16 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze Flonicamid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Flonicamid?
The IUPAC name of Flonicamid (CID 9834513) is N-(cyanomethyl)-4-(trifluoromethyl)pyridine-3-carboxamide.
What is the SMILES notation for Flonicamid?
The canonical SMILES for Flonicamid is C1=CN=CC(=C1C(F)(F)F)C(=O)NCC#N.
What is the InChIKey of Flonicamid?
The InChIKey is RLQJEEJISHYWON-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F3N3O/c10-9(11,12)7-1-3-14-5-6(7)8(16)15-4-2-13/h1,3,5H,4H2,(H,15,16).
What are the key properties of Flonicamid?
Flonicamid has a molecular weight of 229.16 g/mol, XLogP of 0.80, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Flonicamid is sourced from PubChem (CID 9834513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).