C19H22N2O5S — CID 42847493
4-(benzenesulfonyl)-1-(2,4-dimethoxyphenyl)-3-methylpiperazin-2-one (PubChem CID 42847493) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-1-(2,4-dimethoxyphenyl)-3-methylpiperazin-2-one.
| Compound Name | 4-(benzenesulfonyl)-1-(2,4-dimethoxyphenyl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 42847493 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 4-(benzenesulfonyl)-1-(2,4-dimethoxyphenyl)-3-methylpiperazin-2-one |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)c3ccccc3)C(C)C2=O)c(OC)c1 |
| InChI | InChI=1S/C19H22N2O5S/c1-14-19(22)20(17-10-9-15(25-2)13-18(17)26-3)11-12-21(14)27(23,24)16-7-5-4-6-8-16/h4-10,13-14H,11-12H2,1-3H3 |
| InChIKey | HHFUDFNFUXDLND-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |