C20H24N2O3S — CID 93290919
(3S)-4-(benzenesulfonyl)-3-methyl-1-(4-propan-2-ylphenyl)piperazin-2-one (PubChem CID 93290919) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is (3S)-4-(benzenesulfonyl)-3-methyl-1-(4-propan-2-ylphenyl)piperazin-2-one.
| Compound Name | (3S)-4-(benzenesulfonyl)-3-methyl-1-(4-propan-2-ylphenyl)piperazin-2-one |
|---|---|
| PubChem CID | 93290919 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (3S)-4-(benzenesulfonyl)-3-methyl-1-(4-propan-2-ylphenyl)piperazin-2-one |
| SMILES | CC(C)c1ccc(N2CCN(S(=O)(=O)c3ccccc3)[C@@H](C)C2=O)cc1 |
| InChI | InChI=1S/C20H24N2O3S/c1-15(2)17-9-11-18(12-10-17)21-13-14-22(16(3)20(21)23)26(24,25)19-7-5-4-6-8-19/h4-12,15-16H,13-14H2,1-3H3/t16-/m0/s1 |
| InChIKey | VOAFLPIUWZPPTM-INIZCTEOSA-N |
| XLogP | 3.24 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |