C17H15ClF2N2O3S — CID 42847502
1-(3-chloro-4-fluorophenyl)-4-(4-fluorophenyl)sulfonyl-3-methylpiperazin-2-one (PubChem CID 42847502) has the molecular formula C17H15ClF2N2O3S and a molecular weight of 400.83 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-4-(4-fluorophenyl)sulfonyl-3-methylpiperazin-2-one.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-4-(4-fluorophenyl)sulfonyl-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 42847502 |
| Molecular Formula | C17H15ClF2N2O3S |
| Molecular Weight | 400.83 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-4-(4-fluorophenyl)sulfonyl-3-methylpiperazin-2-one |
| SMILES | CC1C(=O)N(c2ccc(F)c(Cl)c2)CCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15ClF2N2O3S/c1-11-17(23)21(13-4-7-16(20)15(18)10-13)8-9-22(11)26(24,25)14-5-2-12(19)3-6-14/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | RVTKSORRBAEAAO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.83 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |