C15H18ClFN2O2 — CID 24718908
1-(3-chloro-4-fluorophenyl)-3-methyl-4-(2-methylpropanoyl)piperazin-2-one (PubChem CID 24718908) has the molecular formula C15H18ClFN2O2 and a molecular weight of 312.77 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-methyl-4-(2-methylpropanoyl)piperazin-2-one.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-methyl-4-(2-methylpropanoyl)piperazin-2-one |
|---|---|
| PubChem CID | 24718908 |
| Molecular Formula | C15H18ClFN2O2 |
| Molecular Weight | 312.77 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-methyl-4-(2-methylpropanoyl)piperazin-2-one |
| SMILES | CC(C)C(=O)N1CCN(c2ccc(F)c(Cl)c2)C(=O)C1C |
| InChI | InChI=1S/C15H18ClFN2O2/c1-9(2)14(20)18-6-7-19(15(21)10(18)3)11-4-5-13(17)12(16)8-11/h4-5,8-10H,6-7H2,1-3H3 |
| InChIKey | UNZPPYUVBHBGPX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.77 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |